C11H10FN5OS — CID 79500482
N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-fluoropyridine-4-carboxamide (PubChem CID 79500482) has the molecular formula C11H10FN5OS and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-fluoropyridine-4-carboxamide.
| Compound Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 79500482 |
| Molecular Formula | C11H10FN5OS |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-(4-carbamothioyl-1-methylpyrazol-5-yl)-3-fluoropyridine-4-carboxamide |
| SMILES | Cn1ncc(C(N)=S)c1NC(=O)c1ccncc1F |
| InChI | InChI=1S/C11H10FN5OS/c1-17-10(7(4-15-17)9(13)19)16-11(18)6-2-3-14-5-8(6)12/h2-5H,1H3,(H2,13,19)(H,16,18) |
| InChIKey | OSWPWIIZAKENRL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|