C12H15ClN4O2 — CID 79161056
N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 79161056) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 79161056 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-[5-chloro-2-(N'-hydroxycarbamimidoyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | NC(=NO)c1ccc(Cl)cc1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H15ClN4O2/c13-8-3-4-9(11(14)16-19)10(7-8)15-12(18)17-5-1-2-6-17/h3-4,7,19H,1-2,5-6H2,(H2,14,16)(H,15,18) |
| InChIKey | DPGIXQQESIXJTL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|