C11H14ClN3O4S — CID 104521819
N-[5-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methylsulfonylpropanamide (PubChem CID 104521819) has the molecular formula C11H14ClN3O4S and a molecular weight of 319.77 g/mol. Its IUPAC name is N-[5-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methylsulfonylpropanamide.
| Compound Name | N-[5-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104521819 |
| Molecular Formula | C11H14ClN3O4S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[5-chloro-2-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)ccc1/C(N)=N/O)S(C)(=O)=O |
| InChI | InChI=1S/C11H14ClN3O4S/c1-6(20(2,18)19)11(16)14-9-5-7(12)3-4-8(9)10(13)15-17/h3-6,17H,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | RLTLKWFNABRTQI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 121.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|