C8H8ClF2N3O3S — CID 77050392
4-chloro-2-(difluoromethylsulfonylamino)-N'-hydroxybenzenecarboximidamide (PubChem CID 77050392) has the molecular formula C8H8ClF2N3O3S and a molecular weight of 299.69 g/mol. Its IUPAC name is 4-chloro-2-(difluoromethylsulfonylamino)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-chloro-2-(difluoromethylsulfonylamino)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77050392 |
| Molecular Formula | C8H8ClF2N3O3S |
| Molecular Weight | 299.69 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 4-chloro-2-(difluoromethylsulfonylamino)-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(Cl)cc1NS(=O)(=O)C(F)F |
| InChI | InChI=1S/C8H8ClF2N3O3S/c9-4-1-2-5(7(12)13-15)6(3-4)14-18(16,17)8(10)11/h1-3,8,14-15H,(H2,12,13) |
| InChIKey | XKZNYIIMIZPKRR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.69 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|