C11H9Cl2N3O3S2 — CID 77050384
4-chloro-2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxybenzenecarboximidamide (PubChem CID 77050384) has the molecular formula C11H9Cl2N3O3S2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-chloro-2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-chloro-2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77050384 |
| Molecular Formula | C11H9Cl2N3O3S2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 4-chloro-2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1ccc(Cl)cc1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H9Cl2N3O3S2/c12-6-1-2-7(11(14)15-17)8(5-6)16-21(18,19)10-4-3-9(13)20-10/h1-5,16-17H,(H2,14,15) |
| InChIKey | ROYXKBLIJODSBU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|