C12H12ClN3O3S2 — CID 107801051
2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-6-methylbenzenecarboximidamide (PubChem CID 107801051) has the molecular formula C12H12ClN3O3S2 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-6-methylbenzenecarboximidamide.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-6-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 107801051 |
| Molecular Formula | C12H12ClN3O3S2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfonylamino]-N'-hydroxy-6-methylbenzenecarboximidamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(Cl)s2)c1/C(N)=N/O |
| InChI | InChI=1S/C12H12ClN3O3S2/c1-7-3-2-4-8(11(7)12(14)15-17)16-21(18,19)10-6-5-9(13)20-10/h2-6,16-17H,1H3,(H2,14,15) |
| InChIKey | QHOAPINJZSPTRC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|