C18H15ClN2O2S2 — CID 58444147
5-chloro-N-(5,8-dimethyl-9H-carbazol-1-yl)thiophene-2-sulfonamide (PubChem CID 58444147) has the molecular formula C18H15ClN2O2S2 and a molecular weight of 390.92 g/mol. Its IUPAC name is 5-chloro-N-(5,8-dimethyl-9H-carbazol-1-yl)thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(5,8-dimethyl-9H-carbazol-1-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 58444147 |
| Molecular Formula | C18H15ClN2O2S2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 5-chloro-N-(5,8-dimethyl-9H-carbazol-1-yl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(C)c2c1[nH]c1c(NS(=O)(=O)c3ccc(Cl)s3)cccc12 |
| InChI | InChI=1S/C18H15ClN2O2S2/c1-10-6-7-11(2)17-16(10)12-4-3-5-13(18(12)20-17)21-25(22,23)15-9-8-14(19)24-15/h3-9,20-21H,1-2H3 |
| InChIKey | BKEDCLNUVAGTAW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |