C13H15ClN2O2S2 — CID 166328784
N-(6-tert-butyl-2-pyridinyl)-5-chlorothiophene-2-sulfonamide (PubChem CID 166328784) has the molecular formula C13H15ClN2O2S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is N-(6-tert-butyl-2-pyridinyl)-5-chlorothiophene-2-sulfonamide.
| Compound Name | N-(6-tert-butyl-2-pyridinyl)-5-chlorothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166328784 |
| Molecular Formula | C13H15ClN2O2S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N-(6-tert-butyl-2-pyridinyl)-5-chlorothiophene-2-sulfonamide |
| SMILES | CC(C)(C)c1cccc(NS(=O)(=O)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C13H15ClN2O2S2/c1-13(2,3)9-5-4-6-11(15-9)16-20(17,18)12-8-7-10(14)19-12/h4-8H,1-3H3,(H,15,16) |
| InChIKey | KQRRTAUMUFMQNP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |