About 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide
5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide (PubChem CID 10193429) has the molecular formula C11H12ClN3O3S2
and a molecular weight of 333.82 g/mol. Its IUPAC name is 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide |
| PubChem CID | 10193429 |
| Molecular Formula | C11H12ClN3O3S2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide |
| SMILES | COc1nc(C)c(C)nc1NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H12ClN3O3S2/c1-6-7(2)14-11(18-3)10(13-6)15-20(16,17)9-5-4-8(12)19-9/h4-5H,1-3H3,(H,13,15) |
| InChIKey | XUNIZEQPRYPTAL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide (CID 10193429) is 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide is COc1nc(C)c(C)nc1NS(=O)(=O)c1ccc(Cl)s1.
What is the InChIKey of 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide?
The InChIKey is XUNIZEQPRYPTAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3O3S2/c1-6-7(2)14-11(18-3)10(13-6)15-20(16,17)9-5-4-8(12)19-9/h4-5H,1-3H3,(H,13,15).
What are the key properties of 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide?
5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide has a molecular weight of 333.82 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(3-methoxy-5,6-dimethylpyrazin-2-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 10193429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).