C18H12Cl2N4O2S2 — CID 2444236
5-chloro-N-[3-(2-chloroanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2444236) has the molecular formula C18H12Cl2N4O2S2 and a molecular weight of 451.36 g/mol. Its IUPAC name is 5-chloro-N-[3-(2-chloroanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(2-chloroanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2444236 |
| Molecular Formula | C18H12Cl2N4O2S2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 5-chloro-N-[3-(2-chloroanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1ccccc1Cl)c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H12Cl2N4O2S2/c19-11-5-1-2-6-12(11)21-17-18(23-14-8-4-3-7-13(14)22-17)24-28(25,26)16-10-9-15(20)27-16/h1-10H,(H,21,22)(H,23,24) |
| InChIKey | YYGLAUIMVJXFBX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |