C18H13BrN4O2S2 — CID 2444391
N-(3-anilinoquinoxalin-2-yl)-5-bromothiophene-2-sulfonamide (PubChem CID 2444391) has the molecular formula C18H13BrN4O2S2 and a molecular weight of 461.37 g/mol. Its IUPAC name is N-(3-anilinoquinoxalin-2-yl)-5-bromothiophene-2-sulfonamide.
| Compound Name | N-(3-anilinoquinoxalin-2-yl)-5-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2444391 |
| Molecular Formula | C18H13BrN4O2S2 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 459.97 |
| IUPAC Name | N-(3-anilinoquinoxalin-2-yl)-5-bromothiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1ccccc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C18H13BrN4O2S2/c19-15-10-11-16(26-15)27(24,25)23-18-17(20-12-6-2-1-3-7-12)21-13-8-4-5-9-14(13)22-18/h1-11H,(H,20,21)(H,22,23) |
| InChIKey | ZKEDKXRZMLMDGP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |