C18H14N4O3S2 — CID 2310368
N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2310368) has the molecular formula C18H14N4O3S2 and a molecular weight of 398.47 g/mol. Its IUPAC name is N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2310368 |
| Molecular Formula | C18H14N4O3S2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-[3-(4-hydroxyanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1ccc(O)cc1)c1cccs1 |
| InChI | InChI=1S/C18H14N4O3S2/c23-13-9-7-12(8-10-13)19-17-18(21-15-5-2-1-4-14(15)20-17)22-27(24,25)16-6-3-11-26-16/h1-11,23H,(H,19,20)(H,21,22) |
| InChIKey | OMHLQKYDIWLLOJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|