C22H22N4O2S2 — CID 2310349
N-[3-(4-butylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2310349) has the molecular formula C22H22N4O2S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N-[3-(4-butylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(4-butylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2310349 |
| Molecular Formula | C22H22N4O2S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[3-(4-butylanilino)quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | CCCCc1ccc(Nc2nc3ccccc3nc2NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H22N4O2S2/c1-2-3-7-16-11-13-17(14-12-16)23-21-22(25-19-9-5-4-8-18(19)24-21)26-30(27,28)20-10-6-15-29-20/h4-6,8-15H,2-3,7H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | OQOALGFCXILITR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |