C19H13F3N4O3S2 — CID 2310739
N-[3-[4-(trifluoromethoxy)anilino]quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2310739) has the molecular formula C19H13F3N4O3S2 and a molecular weight of 466.47 g/mol. Its IUPAC name is N-[3-[4-(trifluoromethoxy)anilino]quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[4-(trifluoromethoxy)anilino]quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2310739 |
| Molecular Formula | C19H13F3N4O3S2 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | N-[3-[4-(trifluoromethoxy)anilino]quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1nc2ccccc2nc1Nc1ccc(OC(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C19H13F3N4O3S2/c20-19(21,22)29-13-9-7-12(8-10-13)23-17-18(25-15-5-2-1-4-14(15)24-17)26-31(27,28)16-6-3-11-30-16/h1-11H,(H,23,24)(H,25,26) |
| InChIKey | HTRIGSRYWZAOSG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |