C20H18N4O2S2 — CID 2309799
N-[3-[[(1R)-1-phenylethyl]amino]quinoxalin-2-yl]thiophene-2-sulfonamide (PubChem CID 2309799) has the molecular formula C20H18N4O2S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[3-[[(1R)-1-phenylethyl]amino]quinoxalin-2-yl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[[(1R)-1-phenylethyl]amino]quinoxalin-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2309799 |
| Molecular Formula | C20H18N4O2S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[3-[[(1R)-1-phenylethyl]amino]quinoxalin-2-yl]thiophene-2-sulfonamide |
| SMILES | C[C@@H](Nc1nc2ccccc2nc1NS(=O)(=O)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O2S2/c1-14(15-8-3-2-4-9-15)21-19-20(23-17-11-6-5-10-16(17)22-19)24-28(25,26)18-12-7-13-27-18/h2-14H,1H3,(H,21,22)(H,23,24)/t14-/m1/s1 |
| InChIKey | MGDNWBHLYUSOKL-CQSZACIVSA-N |
| XLogP | 4.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |