C24H22FN5O3S — CID 26950479
N-[4-[[3-[[(1S)-1-(4-fluorophenyl)ethyl]amino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 26950479) has the molecular formula C24H22FN5O3S and a molecular weight of 479.54 g/mol. Its IUPAC name is N-[4-[[3-[[(1S)-1-(4-fluorophenyl)ethyl]amino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[3-[[(1S)-1-(4-fluorophenyl)ethyl]amino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 26950479 |
| Molecular Formula | C24H22FN5O3S |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | N-[4-[[3-[[(1S)-1-(4-fluorophenyl)ethyl]amino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2N[C@@H](C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H22FN5O3S/c1-15(17-7-9-18(25)10-8-17)26-23-24(29-22-6-4-3-5-21(22)28-23)30-34(32,33)20-13-11-19(12-14-20)27-16(2)31/h3-15H,1-2H3,(H,26,28)(H,27,31)(H,29,30)/t15-/m0/s1 |
| InChIKey | UGCVXKKYBALPJN-HNNXBMFYSA-N |
| XLogP | 4.70 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |