C24H31N5O3S — CID 2297789
N-[4-[[3-(dibutylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 2297789) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[4-[[3-(dibutylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[3-(dibutylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2297789 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[4-[[3-(dibutylamino)quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CCCCN(CCCC)c1nc2ccccc2nc1NS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C24H31N5O3S/c1-4-6-16-29(17-7-5-2)24-23(26-21-10-8-9-11-22(21)27-24)28-33(31,32)20-14-12-19(13-15-20)25-18(3)30/h8-15H,4-7,16-17H2,1-3H3,(H,25,30)(H,26,28) |
| InChIKey | CYNABGJOKTZYBA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |