C27H29N5O7S — CID 56966768
N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 56966768) has the molecular formula C27H29N5O7S and a molecular weight of 567.62 g/mol. Its IUPAC name is N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 56966768 |
| Molecular Formula | C27H29N5O7S |
| Molecular Weight | 567.62 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(NC(C)=O)cc2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C27H29N5O7S/c1-17(34)28-18-9-11-20(12-10-18)40(35,36)32-27-26(29-21-7-4-5-8-22(21)30-27)31-23-15-19(37-2)16-24(38-3)25(23)39-14-6-13-33/h4-5,7-12,15-16,33H,6,13-14H2,1-3H3,(H,28,34)(H,29,31)(H,30,32) |
| InChIKey | HPQBYRWLECBWCF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 161.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|