C25H27N5O5S2 — CID 123691620
N-[3-(2-butoxy-3,5-dimethoxyanilino)quinoxalin-2-yl]-1-(1-cyanoethenylsulfanyl)ethenesulfonamide (PubChem CID 123691620) has the molecular formula C25H27N5O5S2 and a molecular weight of 541.66 g/mol. Its IUPAC name is N-[3-(2-butoxy-3,5-dimethoxyanilino)quinoxalin-2-yl]-1-(1-cyanoethenylsulfanyl)ethenesulfonamide.
| Compound Name | N-[3-(2-butoxy-3,5-dimethoxyanilino)quinoxalin-2-yl]-1-(1-cyanoethenylsulfanyl)ethenesulfonamide |
|---|---|
| PubChem CID | 123691620 |
| Molecular Formula | C25H27N5O5S2 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N-[3-(2-butoxy-3,5-dimethoxyanilino)quinoxalin-2-yl]-1-(1-cyanoethenylsulfanyl)ethenesulfonamide |
| SMILES | C=C(C#N)SC(=C)S(=O)(=O)Nc1nc2ccccc2nc1Nc1cc(OC)cc(OC)c1OCCCC |
| InChI | InChI=1S/C25H27N5O5S2/c1-6-7-12-35-23-21(13-18(33-4)14-22(23)34-5)29-24-25(28-20-11-9-8-10-19(20)27-24)30-37(31,32)17(3)36-16(2)15-26/h8-11,13-14H,2-3,6-7,12H2,1,4-5H3,(H,27,29)(H,28,30) |
| InChIKey | CTKWFASSANCCHY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|