C28H31N5O8S — CID 56966553
ethyl N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]carbamate (PubChem CID 56966553) has the molecular formula C28H31N5O8S and a molecular weight of 597.65 g/mol. Its IUPAC name is ethyl N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 56966553 |
| Molecular Formula | C28H31N5O8S |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | ethyl N-[4-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]sulfamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)Nc2nc3ccccc3nc2Nc2cc(OC)cc(OC)c2OCCCO)cc1 |
| InChI | InChI=1S/C28H31N5O8S/c1-4-40-28(35)29-18-10-12-20(13-11-18)42(36,37)33-27-26(30-21-8-5-6-9-22(21)31-27)32-23-16-19(38-2)17-24(39-3)25(23)41-15-7-14-34/h5-6,8-13,16-17,34H,4,7,14-15H2,1-3H3,(H,29,35)(H,30,32)(H,31,33) |
| InChIKey | ZWLOPKZGRBQVBY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 170.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|