C29H33N5O6S — CID 56967233
4-(azetidin-1-ylmethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide (PubChem CID 56967233) has the molecular formula C29H33N5O6S and a molecular weight of 579.68 g/mol. Its IUPAC name is 4-(azetidin-1-ylmethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | 4-(azetidin-1-ylmethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 56967233 |
| Molecular Formula | C29H33N5O6S |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 4-(azetidin-1-ylmethyl)-N-[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]benzenesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(CN3CCC3)cc2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C29H33N5O6S/c1-38-21-17-25(27(26(18-21)39-2)40-16-6-15-35)32-28-29(31-24-8-4-3-7-23(24)30-28)33-41(36,37)22-11-9-20(10-12-22)19-34-13-5-14-34/h3-4,7-12,17-18,35H,5-6,13-16,19H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | DYKFQMRQWIFOFN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 135.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|