C21H23F3N4O7S — CID 56966767
1,1,1-trifluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide (PubChem CID 56966767) has the molecular formula C21H23F3N4O7S and a molecular weight of 532.50 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 56966767 |
| Molecular Formula | C21H23F3N4O7S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-[2-[2-(2-hydroxyethoxy)ethoxy]-3,5-dimethoxyanilino]quinoxalin-2-yl]methanesulfonamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)C(F)(F)F)c(OCCOCCO)c(OC)c1 |
| InChI | InChI=1S/C21H23F3N4O7S/c1-32-13-11-16(18(17(12-13)33-2)35-10-9-34-8-7-29)27-19-20(28-36(30,31)21(22,23)24)26-15-6-4-3-5-14(15)25-19/h3-6,11-12,29H,7-10H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | JVQUVTTWZNDKKI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 141.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|