C29H33N5O7S — CID 122642854
3-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]-methylsulfamoyl]-N,N-dimethylbenzamide (PubChem CID 122642854) has the molecular formula C29H33N5O7S and a molecular weight of 595.68 g/mol. Its IUPAC name is 3-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]-methylsulfamoyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]-methylsulfamoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 122642854 |
| Molecular Formula | C29H33N5O7S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 3-[[3-[2-(3-hydroxypropoxy)-3,5-dimethoxyanilino]quinoxalin-2-yl]-methylsulfamoyl]-N,N-dimethylbenzamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2N(C)S(=O)(=O)c2cccc(C(=O)N(C)C)c2)c(OCCCO)c(OC)c1 |
| InChI | InChI=1S/C29H33N5O7S/c1-33(2)29(36)19-10-8-11-21(16-19)42(37,38)34(3)28-27(30-22-12-6-7-13-23(22)32-28)31-24-17-20(39-4)18-25(40-5)26(24)41-15-9-14-35/h6-8,10-13,16-18,35H,9,14-15H2,1-5H3,(H,30,31) |
| InChIKey | XBDWXXMJDXWWIS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|