C21H24N4O4 — CID 122636232
3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide (PubChem CID 122636232) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide.
| Compound Name | 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 122636232 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2C(N)=O)c(CCCCO)c(OC)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-28-13-11-17(14(7-5-6-10-26)18(12-13)29-2)25-21-19(20(22)27)23-15-8-3-4-9-16(15)24-21/h3-4,8-9,11-12,26H,5-7,10H2,1-2H3,(H2,22,27)(H,24,25) |
| InChIKey | HMQXASNSOXDHGC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|