About 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide
3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide (PubChem CID 122636232) has the molecular formula C21H24N4O4
and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide.
Molecular Properties
| Compound Name | 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide |
| PubChem CID | 122636232 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide |
| SMILES | COc1cc(Nc2nc3ccccc3nc2C(N)=O)c(CCCCO)c(OC)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-28-13-11-17(14(7-5-6-10-26)18(12-13)29-2)25-21-19(20(22)27)23-15-8-3-4-9-16(15)24-21/h3-4,8-9,11-12,26H,5-7,10H2,1-2H3,(H2,22,27)(H,24,25) |
| InChIKey | HMQXASNSOXDHGC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide?
The IUPAC name of 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide (CID 122636232) is 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide.
What is the SMILES notation for 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide?
The canonical SMILES for 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide is COc1cc(Nc2nc3ccccc3nc2C(N)=O)c(CCCCO)c(OC)c1.
What is the InChIKey of 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide?
The InChIKey is HMQXASNSOXDHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O4/c1-28-13-11-17(14(7-5-6-10-26)18(12-13)29-2)25-21-19(20(22)27)23-15-8-3-4-9-16(15)24-21/h3-4,8-9,11-12,26H,5-7,10H2,1-2H3,(H2,22,27)(H,24,25).
What are the key properties of 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide?
3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide has a molecular weight of 396.45 g/mol, XLogP of 2.80, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-hydroxybutyl)-3,5-dimethoxyanilino]quinoxaline-2-carboxamide is sourced from PubChem (CID 122636232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).