C19H19N3O4 — CID 1192543
ethyl 4-(2,5-dimethoxyanilino)quinazoline-2-carboxylate (PubChem CID 1192543) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is ethyl 4-(2,5-dimethoxyanilino)quinazoline-2-carboxylate.
| Compound Name | ethyl 4-(2,5-dimethoxyanilino)quinazoline-2-carboxylate |
|---|---|
| PubChem CID | 1192543 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | ethyl 4-(2,5-dimethoxyanilino)quinazoline-2-carboxylate |
| SMILES | CCOC(=O)c1nc(Nc2cc(OC)ccc2OC)c2ccccc2n1 |
| InChI | InChI=1S/C19H19N3O4/c1-4-26-19(23)18-20-14-8-6-5-7-13(14)17(22-18)21-15-11-12(24-2)9-10-16(15)25-3/h5-11H,4H2,1-3H3,(H,20,21,22) |
| InChIKey | JUMBNDWBTNHIOC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |