C21H22N2O5 — CID 22333868
ethyl 4-(2,5-dimethoxyanilino)-8-methoxyquinoline-3-carboxylate (PubChem CID 22333868) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is ethyl 4-(2,5-dimethoxyanilino)-8-methoxyquinoline-3-carboxylate.
| Compound Name | ethyl 4-(2,5-dimethoxyanilino)-8-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 22333868 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | ethyl 4-(2,5-dimethoxyanilino)-8-methoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C21H22N2O5/c1-5-28-21(24)15-12-22-20-14(7-6-8-18(20)27-4)19(15)23-16-11-13(25-2)9-10-17(16)26-3/h6-12H,5H2,1-4H3,(H,22,23) |
| InChIKey | WCRIWIVWRXHLIP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |