C21H21ClN2O5 — CID 18590598
3-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]-4-methylbenzoic acid;hydrochloride (PubChem CID 18590598) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is 3-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]-4-methylbenzoic acid;hydrochloride.
| Compound Name | 3-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]-4-methylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 18590598 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 3-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]-4-methylbenzoic acid;hydrochloride |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1Nc1cc(C(=O)O)ccc1C.Cl |
| InChI | InChI=1S/C21H20N2O5.ClH/c1-4-28-21(26)15-11-22-19-14(6-5-7-17(19)27-3)18(15)23-16-10-13(20(24)25)9-8-12(16)2;/h5-11H,4H2,1-3H3,(H,22,23)(H,24,25);1H |
| InChIKey | QWTLLILFEYTJKO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |