C19H23N2O5- — CID 7320785
6-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]hexanoate (PubChem CID 7320785) has the molecular formula C19H23N2O5- and a molecular weight of 359.40 g/mol. Its IUPAC name is 6-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]hexanoate.
| Compound Name | 6-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]hexanoate |
|---|---|
| PubChem CID | 7320785 |
| Molecular Formula | C19H23N2O5- |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 6-[(3-ethoxycarbonyl-8-methoxyquinolin-4-yl)amino]hexanoate |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1NCCCCCC(=O)[O-] |
| InChI | InChI=1S/C19H24N2O5/c1-3-26-19(24)14-12-21-18-13(8-7-9-15(18)25-2)17(14)20-11-6-4-5-10-16(22)23/h7-9,12H,3-6,10-11H2,1-2H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | XVFJGHCSLRHLJI-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|