C20H21ClN2O4 — CID 13038443
ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride (PubChem CID 13038443) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride.
| Compound Name | ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 13038443 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl 8-methoxy-4-(2-methoxyanilino)quinoline-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1Nc1ccccc1OC.Cl |
| InChI | InChI=1S/C20H20N2O4.ClH/c1-4-26-20(23)14-12-21-19-13(8-7-11-17(19)25-3)18(14)22-15-9-5-6-10-16(15)24-2;/h5-12H,4H2,1-3H3,(H,21,22);1H |
| InChIKey | GWABEZHJVSPHNE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |