C21H24N2O4 — CID 20529010
ethyl 8-methoxy-4-(1-phenylethylamino)quinoline-3-carboxylate;hydrate (PubChem CID 20529010) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl 8-methoxy-4-(1-phenylethylamino)quinoline-3-carboxylate;hydrate.
| Compound Name | ethyl 8-methoxy-4-(1-phenylethylamino)quinoline-3-carboxylate;hydrate |
|---|---|
| PubChem CID | 20529010 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethyl 8-methoxy-4-(1-phenylethylamino)quinoline-3-carboxylate;hydrate |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1NC(C)c1ccccc1.O |
| InChI | InChI=1S/C21H22N2O3.H2O/c1-4-26-21(24)17-13-22-20-16(11-8-12-18(20)25-3)19(17)23-14(2)15-9-6-5-7-10-15;/h5-14H,4H2,1-3H3,(H,22,23);1H2 |
| InChIKey | MJNAFZWEKGYYQT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |