C21H22N2O7P-3 — CID 20529012
ethyl 4-(2-ethylanilino)-8-methoxyquinoline-3-carboxylate phosphate (PubChem CID 20529012) has the molecular formula C21H22N2O7P-3 and a molecular weight of 445.39 g/mol. Its IUPAC name is ethyl 4-(2-ethylanilino)-8-methoxyquinoline-3-carboxylate phosphate.
| Compound Name | ethyl 4-(2-ethylanilino)-8-methoxyquinoline-3-carboxylate phosphate |
|---|---|
| PubChem CID | 20529012 |
| Molecular Formula | C21H22N2O7P-3 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | ethyl 4-(2-ethylanilino)-8-methoxyquinoline-3-carboxylate phosphate |
| SMILES | CCOC(=O)c1cnc2c(OC)cccc2c1Nc1ccccc1CC.O=P([O-])([O-])[O-] |
| InChI | InChI=1S/C21H22N2O3.H3O4P/c1-4-14-9-6-7-11-17(14)23-19-15-10-8-12-18(25-3)20(15)22-13-16(19)21(24)26-5-2;1-5(2,3)4/h6-13H,4-5H2,1-3H3,(H,22,23);(H3,1,2,3,4)/p-3 |
| InChIKey | QZPNMHNGXWHCAY-UHFFFAOYSA-K |
| XLogP | 1.90 |
| TPSA | 146.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|