C22H24N2O3 — CID 23821530
ethyl 8-ethyl-4-(2-methoxy-5-methylanilino)quinoline-3-carboxylate (PubChem CID 23821530) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is ethyl 8-ethyl-4-(2-methoxy-5-methylanilino)quinoline-3-carboxylate.
| Compound Name | ethyl 8-ethyl-4-(2-methoxy-5-methylanilino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 23821530 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethyl 8-ethyl-4-(2-methoxy-5-methylanilino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(CC)cccc2c1Nc1cc(C)ccc1OC |
| InChI | InChI=1S/C22H24N2O3/c1-5-15-8-7-9-16-20(15)23-13-17(22(25)27-6-2)21(16)24-18-12-14(3)10-11-19(18)26-4/h7-13H,5-6H2,1-4H3,(H,23,24) |
| InChIKey | UHBPGNMMDQGROW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |