C20H22N4O2 — CID 10066474
ethyl 8-amino-4-[2-(2-aminophenyl)ethylamino]quinoline-3-carboxylate (PubChem CID 10066474) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 8-amino-4-[2-(2-aminophenyl)ethylamino]quinoline-3-carboxylate.
| Compound Name | ethyl 8-amino-4-[2-(2-aminophenyl)ethylamino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 10066474 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | ethyl 8-amino-4-[2-(2-aminophenyl)ethylamino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(N)cccc2c1NCCc1ccccc1N |
| InChI | InChI=1S/C20H22N4O2/c1-2-26-20(25)15-12-24-19-14(7-5-9-17(19)22)18(15)23-11-10-13-6-3-4-8-16(13)21/h3-9,12H,2,10-11,21-22H2,1H3,(H,23,24) |
| InChIKey | UKZVHDFTXLHGLJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|