C20H18F3N3O2 — CID 10068907
ethyl 8-amino-4-[[3-(trifluoromethyl)phenyl]methylamino]quinoline-3-carboxylate (PubChem CID 10068907) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is ethyl 8-amino-4-[[3-(trifluoromethyl)phenyl]methylamino]quinoline-3-carboxylate.
| Compound Name | ethyl 8-amino-4-[[3-(trifluoromethyl)phenyl]methylamino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 10068907 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 8-amino-4-[[3-(trifluoromethyl)phenyl]methylamino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(N)cccc2c1NCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H18F3N3O2/c1-2-28-19(27)15-11-26-18-14(7-4-8-16(18)24)17(15)25-10-12-5-3-6-13(9-12)20(21,22)23/h3-9,11H,2,10,24H2,1H3,(H,25,26) |
| InChIKey | OLDSWGLVGPOXNB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|