C20H20Cl2N2O2 — CID 2789452
ethyl 4-(benzylamino)-7-chloro-8-methylquinoline-3-carboxylate;hydrochloride (PubChem CID 2789452) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is ethyl 4-(benzylamino)-7-chloro-8-methylquinoline-3-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(benzylamino)-7-chloro-8-methylquinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 2789452 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | ethyl 4-(benzylamino)-7-chloro-8-methylquinoline-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnc2c(C)c(Cl)ccc2c1NCc1ccccc1.Cl |
| InChI | InChI=1S/C20H19ClN2O2.ClH/c1-3-25-20(24)16-12-23-18-13(2)17(21)10-9-15(18)19(16)22-11-14-7-5-4-6-8-14;/h4-10,12H,3,11H2,1-2H3,(H,22,23);1H |
| InChIKey | NRUGWDCELBWOMC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |