C17H14Cl2N2O3 — CID 1189481
ethyl 6,8-dichloro-4-(furan-2-ylmethylamino)quinoline-3-carboxylate (PubChem CID 1189481) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is ethyl 6,8-dichloro-4-(furan-2-ylmethylamino)quinoline-3-carboxylate.
| Compound Name | ethyl 6,8-dichloro-4-(furan-2-ylmethylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 1189481 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | ethyl 6,8-dichloro-4-(furan-2-ylmethylamino)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(Cl)cc(Cl)cc2c1NCc1ccco1 |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-2-23-17(22)13-9-21-16-12(6-10(18)7-14(16)19)15(13)20-8-11-4-3-5-24-11/h3-7,9H,2,8H2,1H3,(H,20,21) |
| InChIKey | ZCHSWYMBONMXRK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |