C18H25ClN3O2+ — CID 3354209
3-[(6-chloro-3-ethoxycarbonyl-8-methylquinolin-4-yl)amino]propyl-dimethylazanium (PubChem CID 3354209) has the molecular formula C18H25ClN3O2+ and a molecular weight of 350.87 g/mol. Its IUPAC name is 3-[(6-chloro-3-ethoxycarbonyl-8-methylquinolin-4-yl)amino]propyl-dimethylazanium.
| Compound Name | 3-[(6-chloro-3-ethoxycarbonyl-8-methylquinolin-4-yl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 3354209 |
| Molecular Formula | C18H25ClN3O2+ |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-[(6-chloro-3-ethoxycarbonyl-8-methylquinolin-4-yl)amino]propyl-dimethylazanium |
| SMILES | CCOC(=O)c1cnc2c(C)cc(Cl)cc2c1NCCC[NH+](C)C |
| InChI | InChI=1S/C18H24ClN3O2/c1-5-24-18(23)15-11-21-16-12(2)9-13(19)10-14(16)17(15)20-7-6-8-22(3)4/h9-11H,5-8H2,1-4H3,(H,20,21)/p+1 |
| InChIKey | JGQQBLDEWOBIGQ-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|