C20H28N3O4+ — CID 3354208
3-[[3,6-bis(ethoxycarbonyl)quinolin-4-yl]amino]propyl-dimethylazanium (PubChem CID 3354208) has the molecular formula C20H28N3O4+ and a molecular weight of 374.46 g/mol. Its IUPAC name is 3-[[3,6-bis(ethoxycarbonyl)quinolin-4-yl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[3,6-bis(ethoxycarbonyl)quinolin-4-yl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 3354208 |
| Molecular Formula | C20H28N3O4+ |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[[3,6-bis(ethoxycarbonyl)quinolin-4-yl]amino]propyl-dimethylazanium |
| SMILES | CCOC(=O)c1ccc2ncc(C(=O)OCC)c(NCCC[NH+](C)C)c2c1 |
| InChI | InChI=1S/C20H27N3O4/c1-5-26-19(24)14-8-9-17-15(12-14)18(21-10-7-11-23(3)4)16(13-22-17)20(25)27-6-2/h8-9,12-13H,5-7,10-11H2,1-4H3,(H,21,22)/p+1 |
| InChIKey | VEUXHOPWCCVNPH-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|