C23H27N3O3 — CID 172914482
ethyl 4-[3-(dimethylamino)propylamino]-6-phenoxyquinoline-3-carboxylate (PubChem CID 172914482) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is ethyl 4-[3-(dimethylamino)propylamino]-6-phenoxyquinoline-3-carboxylate.
| Compound Name | ethyl 4-[3-(dimethylamino)propylamino]-6-phenoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 172914482 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | ethyl 4-[3-(dimethylamino)propylamino]-6-phenoxyquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(Oc3ccccc3)cc2c1NCCCN(C)C |
| InChI | InChI=1S/C23H27N3O3/c1-4-28-23(27)20-16-25-21-12-11-18(29-17-9-6-5-7-10-17)15-19(21)22(20)24-13-8-14-26(2)3/h5-7,9-12,15-16H,4,8,13-14H2,1-3H3,(H,24,25) |
| InChIKey | KSXNYBUESGPIRA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|