C17H22N2O4 — CID 705522
ethyl 6-ethoxy-4-[[(2S)-2-hydroxypropyl]amino]quinoline-3-carboxylate (PubChem CID 705522) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl 6-ethoxy-4-[[(2S)-2-hydroxypropyl]amino]quinoline-3-carboxylate.
| Compound Name | ethyl 6-ethoxy-4-[[(2S)-2-hydroxypropyl]amino]quinoline-3-carboxylate |
|---|---|
| PubChem CID | 705522 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethyl 6-ethoxy-4-[[(2S)-2-hydroxypropyl]amino]quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(OCC)cc2c1NC[C@H](C)O |
| InChI | InChI=1S/C17H22N2O4/c1-4-22-12-6-7-15-13(8-12)16(19-9-11(3)20)14(10-18-15)17(21)23-5-2/h6-8,10-11,20H,4-5,9H2,1-3H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | LJIJSXULDIAZRF-NSHDSACASA-N |
| XLogP | 2.60 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |