C21H20N2O5 — CID 1187193
3-[(6-ethoxy-3-ethoxycarbonylquinolin-4-yl)amino]benzoic acid (PubChem CID 1187193) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-[(6-ethoxy-3-ethoxycarbonylquinolin-4-yl)amino]benzoic acid.
| Compound Name | 3-[(6-ethoxy-3-ethoxycarbonylquinolin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 1187193 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-[(6-ethoxy-3-ethoxycarbonylquinolin-4-yl)amino]benzoic acid |
| SMILES | CCOC(=O)c1cnc2ccc(OCC)cc2c1Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-3-27-15-8-9-18-16(11-15)19(17(12-22-18)21(26)28-4-2)23-14-7-5-6-13(10-14)20(24)25/h5-12H,3-4H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | WWBWTMXMYOJYAR-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |