C27H25N3O4 — CID 23936289
diethyl 4-(4-anilinoanilino)quinoline-3,6-dicarboxylate (PubChem CID 23936289) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is diethyl 4-(4-anilinoanilino)quinoline-3,6-dicarboxylate.
| Compound Name | diethyl 4-(4-anilinoanilino)quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 23936289 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | diethyl 4-(4-anilinoanilino)quinoline-3,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2ncc(C(=O)OCC)c(Nc3ccc(Nc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C27H25N3O4/c1-3-33-26(31)18-10-15-24-22(16-18)25(23(17-28-24)27(32)34-4-2)30-21-13-11-20(12-14-21)29-19-8-6-5-7-9-19/h5-17,29H,3-4H2,1-2H3,(H,28,30) |
| InChIKey | FZEKVIYKMFVGEA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |