C20H19ClN2O5 — CID 2790549
3-[(3-ethoxycarbonyl-6-methoxyquinolin-4-yl)amino]benzoic acid;hydrochloride (PubChem CID 2790549) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is 3-[(3-ethoxycarbonyl-6-methoxyquinolin-4-yl)amino]benzoic acid;hydrochloride.
| Compound Name | 3-[(3-ethoxycarbonyl-6-methoxyquinolin-4-yl)amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 2790549 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-[(3-ethoxycarbonyl-6-methoxyquinolin-4-yl)amino]benzoic acid;hydrochloride |
| SMILES | CCOC(=O)c1cnc2ccc(OC)cc2c1Nc1cccc(C(=O)O)c1.Cl |
| InChI | InChI=1S/C20H18N2O5.ClH/c1-3-27-20(25)16-11-21-17-8-7-14(26-2)10-15(17)18(16)22-13-6-4-5-12(9-13)19(23)24;/h4-11H,3H2,1-2H3,(H,21,22)(H,23,24);1H |
| InChIKey | RKHNBAGPTZRBSK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |