C18H12N2O5-2 — CID 7137761
4-(3-carboxylatoanilino)-6-methoxyquinoline-3-carboxylate (PubChem CID 7137761) has the molecular formula C18H12N2O5-2 and a molecular weight of 336.30 g/mol. Its IUPAC name is 4-(3-carboxylatoanilino)-6-methoxyquinoline-3-carboxylate.
| Compound Name | 4-(3-carboxylatoanilino)-6-methoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 7137761 |
| Molecular Formula | C18H12N2O5-2 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-(3-carboxylatoanilino)-6-methoxyquinoline-3-carboxylate |
| SMILES | COc1ccc2ncc(C(=O)[O-])c(Nc3cccc(C(=O)[O-])c3)c2c1 |
| InChI | InChI=1S/C18H14N2O5/c1-25-12-5-6-15-13(8-12)16(14(9-19-15)18(23)24)20-11-4-2-3-10(7-11)17(21)22/h2-9H,1H3,(H,19,20)(H,21,22)(H,23,24)/p-2 |
| InChIKey | VJTZFMINKLNGNA-UHFFFAOYSA-L |
| XLogP | 0.71 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |