C24H21N5O4 — CID 11374151
4-(3-methoxyanilino)-6-N-(6-methoxy-3-pyridinyl)quinoline-3,6-dicarboxamide (PubChem CID 11374151) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-6-N-(6-methoxy-3-pyridinyl)quinoline-3,6-dicarboxamide.
| Compound Name | 4-(3-methoxyanilino)-6-N-(6-methoxy-3-pyridinyl)quinoline-3,6-dicarboxamide |
|---|---|
| PubChem CID | 11374151 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-(3-methoxyanilino)-6-N-(6-methoxy-3-pyridinyl)quinoline-3,6-dicarboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3ccc(C(=O)Nc4ccc(OC)nc4)cc23)c1 |
| InChI | InChI=1S/C24H21N5O4/c1-32-17-5-3-4-15(11-17)28-22-18-10-14(6-8-20(18)26-13-19(22)23(25)30)24(31)29-16-7-9-21(33-2)27-12-16/h3-13H,1-2H3,(H2,25,30)(H,26,28)(H,29,31) |
| InChIKey | CGJPDQVDJFBPJW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |