C23H26N4O3S — CID 142969698
4-(3-methoxyanilino)-6-[2-(2-methylpropanoylamino)ethylsulfanyl]quinoline-3-carboxamide (PubChem CID 142969698) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-6-[2-(2-methylpropanoylamino)ethylsulfanyl]quinoline-3-carboxamide.
| Compound Name | 4-(3-methoxyanilino)-6-[2-(2-methylpropanoylamino)ethylsulfanyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 142969698 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-(3-methoxyanilino)-6-[2-(2-methylpropanoylamino)ethylsulfanyl]quinoline-3-carboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)cnc3ccc(SCCNC(=O)C(C)C)cc23)c1 |
| InChI | InChI=1S/C23H26N4O3S/c1-14(2)23(29)25-9-10-31-17-7-8-20-18(12-17)21(19(13-26-20)22(24)28)27-15-5-4-6-16(11-15)30-3/h4-8,11-14H,9-10H2,1-3H3,(H2,24,28)(H,25,29)(H,26,27) |
| InChIKey | UMTHIOOQJLXERS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|