C17H15N3O4S — CID 158839426
4-(3-hydroxyanilino)-6-methylquinoline-3-carboxamide;sulfur dioxide (PubChem CID 158839426) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is 4-(3-hydroxyanilino)-6-methylquinoline-3-carboxamide;sulfur dioxide.
| Compound Name | 4-(3-hydroxyanilino)-6-methylquinoline-3-carboxamide;sulfur dioxide |
|---|---|
| PubChem CID | 158839426 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 4-(3-hydroxyanilino)-6-methylquinoline-3-carboxamide;sulfur dioxide |
| SMILES | Cc1ccc2ncc(C(N)=O)c(Nc3cccc(O)c3)c2c1.O=S=O |
| InChI | InChI=1S/C17H15N3O2.O2S/c1-10-5-6-15-13(7-10)16(14(9-19-15)17(18)22)20-11-3-2-4-12(21)8-11;1-3-2/h2-9,21H,1H3,(H2,18,22)(H,19,20); |
| InChIKey | IYAWYXDZBKZLKW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |