C20H18N4O4 — CID 22076446
4,5-bis(3-hydroxyanilino)benzene-1,2-dicarboxamide (PubChem CID 22076446) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 4,5-bis(3-hydroxyanilino)benzene-1,2-dicarboxamide.
| Compound Name | 4,5-bis(3-hydroxyanilino)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 22076446 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 4,5-bis(3-hydroxyanilino)benzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1cc(Nc2cccc(O)c2)c(Nc2cccc(O)c2)cc1C(N)=O |
| InChI | InChI=1S/C20H18N4O4/c21-19(27)15-9-17(23-11-3-1-5-13(25)7-11)18(10-16(15)20(22)28)24-12-4-2-6-14(26)8-12/h1-10,23-26H,(H2,21,27)(H2,22,28) |
| InChIKey | IKGFGKAMNCAYTK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |