C25H27N3O3 — CID 22076471
methyl 2-carbamoyl-4,5-bis(3-ethylanilino)benzoate (PubChem CID 22076471) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl 2-carbamoyl-4,5-bis(3-ethylanilino)benzoate.
| Compound Name | methyl 2-carbamoyl-4,5-bis(3-ethylanilino)benzoate |
|---|---|
| PubChem CID | 22076471 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | methyl 2-carbamoyl-4,5-bis(3-ethylanilino)benzoate |
| SMILES | CCc1cccc(Nc2cc(C(N)=O)c(C(=O)OC)cc2Nc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-4-16-8-6-10-18(12-16)27-22-14-20(24(26)29)21(25(30)31-3)15-23(22)28-19-11-7-9-17(5-2)13-19/h6-15,27-28H,4-5H2,1-3H3,(H2,26,29) |
| InChIKey | ZWYRGHSXXPDAFC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |