C14H16N4O — CID 114194765
2-amino-5-(3-ethylanilino)pyridine-4-carboxamide (PubChem CID 114194765) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-amino-5-(3-ethylanilino)pyridine-4-carboxamide.
| Compound Name | 2-amino-5-(3-ethylanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114194765 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-amino-5-(3-ethylanilino)pyridine-4-carboxamide |
| SMILES | CCc1cccc(Nc2cnc(N)cc2C(N)=O)c1 |
| InChI | InChI=1S/C14H16N4O/c1-2-9-4-3-5-10(6-9)18-12-8-17-13(15)7-11(12)14(16)19/h3-8,18H,2H2,1H3,(H2,15,17)(H2,16,19) |
| InChIKey | KPPQPFNOQBIDAI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |